Details for Acetic acid octyl ester

Acetic acid octyl ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
112-14-1 |
EC NO: |
203-939-6 |
Molecular Formula: |
C12H26O3 |
Molecular Weight: |
218.333 |
Specification: |
|
InChI: |
InChI=1/C10H20O2.C2H6O/c1-3-4-5-6-7-8-9-12-10(2)11;1-2-3/h3-9H2,1-2H3;3H,2H2,1H3 |
Synonyms: |
Acetate C-8; Acetic acid, octyl ester; n-Octyl Acetate;Acetic Acid Octyl Ester;1-Octyl acetate;1-octanolacetate; |
Molecular Structure: |
 |
if you are sourcing Acetic acid octyl ester from China ,just feel free to inquire