Details for Methyl carbamate

Methyl carbamate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
598-55-0 |
EC NO: |
209-939-2 |
Molecular Formula: |
C2H5NO2 |
Molecular Weight: |
75.0666 |
Specification: |
|
InChI: |
InChI=1/C2H5NO2/c1-5-2(3)4/h1H3,(H2,3,4) |
Synonyms: |
4-03-00-00037 (Beilstein Handbook Reference);AI3-11025;BRN 0635779;CCRIS 885;Carbamic acid, methyl ester;HSDB 2587;Methylcarbamate;Methylester kyseliny karbaminove;Methylester kyseliny karbaminove [Czech];Methylkarbamat;Methylkarbamat [Czech];Methylurethan;NCI-C55594;NSC 3054;Urethylane;Methylurethane;MCM; |
Molecular Structure: |
 |
if you are sourcing Methyl carbamate from China ,just feel free to inquire