Details for L-Valine methyl ester hydrochloride
![](/images/home/newal1.gif)
L-Valine methyl ester hydrochloride
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
6306-52-1 |
EC NO: |
228-620-9 |
Molecular Formula: |
C6H14NO2 |
Molecular Weight: |
132.1803 |
Specification: |
|
InChI: |
InChI=1/C6H13NO2/c1-4(2)5(7)6(8)9-3/h4-5H,7H2,1-3H3/p+1/t5-/m1/s1 |
Synonyms: |
H-Val-OMe.HCl;L-Valine methyl ester HCL;Val-ome.hcl;Methyl valinate hydrochloride;L-Valine Methyl Estet HCL;methyl L-valinate;(2S)-1-methoxy-3-methyl-1-oxobutan-2-aminium;(2R)-1-methoxy-3-methyl-1-oxobutan-2-aminium;Valine methyl ester hydrochloride, L-;H-Val-OMe¡¤HCl;H-Val-OMe•HCl;(S)-Methyl 2-amino-3-methylbutanoate hydrochloride; |
Molecular Structure: |
![L-Valine methyl ester hydrochloride 6306-52-1](https://images-a.chemnet.com/suppliers/chembase/191/191371_1.gif) |
if you are sourcing L-Valine methyl ester hydrochloride from China ,just feel free to inquire