Details for L-Isoleucine ethyl ester hydrochloride
![](/images/home/newal1.gif)
L-Isoleucine ethyl ester hydrochloride
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
56782-52-6 |
EC NO: |
260-382-1 |
Molecular Formula: |
C8H18ClNO2 |
Molecular Weight: |
195.687 |
Specification: |
|
InChI: |
InChI=1/C8H17NO2.ClH/c1-4-6(3)7(9)8(10)11-5-2;/h6-7H,4-5,9H2,1-3H3;1H/t6-,7-;/m0./s1 |
Synonyms: |
ethyl L-isoleucinate hydrochloride;D-Isoleucine Ethyl Ester HCl;Isoleucine ethyl ester hydrochloride; |
Molecular Structure: |
![L-Isoleucine ethyl ester hydrochloride 56782-52-6](https://images-a.chemnet.com/suppliers/chembase/209/209443_1.gif) |
if you are sourcing L-Isoleucine ethyl ester hydrochloride from China ,just feel free to inquire