Details for 6-Methylchrysene

6-Methylchrysene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
1705-85-7 |
| EC NO: |
216-942-2 |
| Molecular Formula: |
C19H14 |
| Molecular Weight: |
242.3145 |
| Specification: |
|
| InChI: |
InChI=1/C19H14/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-12H,1H3 |
| Synonyms: |
6-Methylchrysene;4-05-00-02573 (Beilstein Handbook Reference);BRN 1954732;CCRIS 6759;Chrysene, 6-methyl-;67405 6-METHYLCHRYSENE (PURITY); |
| Molecular Structure: |
 |
if you are sourcing 6-Methylchrysene from United-States ,just feel free to inquire