Details for Allyl Succinic Anhydride
![](/images/home/newal1.gif)
Allyl Succinic Anhydride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
7539-12-0 |
EC NO: |
231-412-0 |
Molecular Formula: |
C7H8O3 |
Molecular Weight: |
140.1366 |
Specification: |
|
InChI: |
InChI=1/C7H8O3/c1-2-3-5-4-6(8)10-7(5)9/h2,5H,1,3-4H2 |
Synonyms: |
Succinic anhydride, allyl-;4-17-00-05922 (Beilstein Handbook Reference);BRN 0111959;3-Allyl(dihydro)furan-2,5-dione;3-(prop-2-en-1-yl)dihydrofuran-2,5-dione; |
Molecular Structure: |
![Allyl Succinic Anhydride 7539-12-0](https://images-a.chemnet.com/suppliers/chembase/cas6/cas7539-12-0.gif) |
if you are sourcing Allyl Succinic Anhydride from United-States ,just feel free to inquire