Details for Methyl 4-nitrobenzoate

Methyl 4-nitrobenzoate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
619-50-1 |
| EC NO: |
210-599-2 |
| Molecular Formula: |
C8H6NO4 |
| Molecular Weight: |
180.1381 |
| Specification: |
|
| InChI: |
InChI=1/C8H7NO4/c1-5-4-6(9(12)13)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| Synonyms: |
Methyl 4-nitrobenzoate/4-Nitrobenzoic acid methyl ester;4-Nitrobenzoic acid methyl ester;Methyl DL-p-Hydroxyphenylglycine;Methyl-p-nitrobenzoate;2-methyl-4-nitrobenzoate; |
| Molecular Structure: |
 |
if you are sourcing Methyl 4-nitrobenzoate from United-States ,just feel free to inquire