year
Category: | Organic chemicals and Derivatives |
|
||||||||||||
CAS NO: | 96-48-0 | |||||||||||||
EC NO: | 202-509-5 | |||||||||||||
Molecular Formula: | C4H8O4 | |||||||||||||
Molecular Weight: | 120.1039 | |||||||||||||
Specification: | ||||||||||||||
InChI: | InChI=1/C4H8O4/c1-2(5)3(6)4(7)8/h2-3,5-6H,1H3,(H,7,8) | |||||||||||||
Product description: Properties:Colorless and transparent oily liquid with a smell similar to that of acetone, the boiling point is 204oC. It can dissolve mutually with water, acetone, benzene, carbon tetrachloride and alcohol at any proportion.
Use: Packing:It is packaged with galvanized buckets (net weight: 200KG), paint coated buckets (net weight: 200KG), HDPE buckets (net weight:200KG), IBC buckets (net weight: 1,OOOKG), ISOTANK (NW: 20MT)and stainless land tankers (30MT). |
||||||||||||||
Synonyms: | 4-Hydroxybutyric acid gamma-lactone;BLO;Butyronitrile,99%;4,5-Dihydro-2(3H)-furanone;4-Hydroxybutyric acid lactone;n-Butyronitrile;γ-butyrolactone;γ-butyrolactone(99.5%);Gamma ButyroLactone;1,4-Butyrolactone;2,3-dihydroxybutanoic acid;GBL;γ-Butyroalctone;Gamma-Butyroalctone;3-Hydroxybutyric acid lactone;2-Oxotetrahydrofuran;2-Oxolanone;2,3,4,5-tetrahydro-2-furanone;2(3H)-furanone,dihydro-;2(3H)-dihydrofuranone;1-Oxacyclopentan-2-one;γ-Butyrrolactone; | |||||||||||||
Molecular Structure: |
![]() |