Details for L-Cysteine HCL Anhydrous
L-Cysteine HCL Anhydrous
| 111Category: |
Food and Feed additives |
|
| CAS NO: |
52-89-1 |
| EC NO: |
200-157-7 |
| Molecular Formula: |
C3H7ClNO2S |
| Molecular Weight: |
156.6117 |
| Specification: |
AJI/USP/FCC |
| InChI: |
InChI=1/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/p-1 |
| Packing: |
25 KG DRUM |
| Uses: |
Nutritional supplement |
| Synonyms: |
L-Cysteine hydrochloride;L-cysteine hcl cell culture tested;H-Cys-OH.HCl;L-Cysteine Hcl Anhydrous;L-Cysteine HCl;Di-isopropyl nahpthalene;L-cysteine hydrochloride (1:1);L-Cysteine HCl anhydrate;cysteine, chloride (1:1);2-(2-Methoxy Ethoxy) Acetaldehyde Dimethyl Actal; |
| Molecular Structure: |
 |
if you are sourcing L-Cysteine HCL Anhydrous from China ,just feel free to inquire
CN
China Suppliers > AWI > 
Search Product