Details for Solvent Orange 63

Solvent Orange 63
111Category: |
Dyestuffs and Pigments |
|
CAS NO: |
16294-75-0 |
EC NO: |
240-385-4 |
Molecular Formula: |
C23H12OS |
Molecular Weight: |
336.4058 |
Specification: |
|
InChI: |
InChI=1/C23H12OS/c24-23-17-7-2-1-5-13(17)15-11-12-20-22-16(9-10-18(23)21(15)22)14-6-3-4-8-19(14)25-20/h1-12H |
Synonyms: |
14H-Anthra(2,1,9-mna)thioxanthen-14-one;Solvent Orange 63;fluorescence orange red GG;Orange GG;Fluorescent Red GG;Plast orange 2002; |
Molecular Structure: |
 |
if you are sourcing Solvent Orange 63 from China ,just feel free to inquire