Details for Triphenyl Phosphite
Triphenyl Phosphite
| 111Category: |
Catalyst and Auxiliary/Other Auxiliary Agent |
|
| CAS NO: |
101-02-0 |
| EC NO: |
202-908-4 |
| Molecular Formula: |
C18H15O3P |
| Molecular Weight: |
310.2837 |
| Specification: |
|
| InChI: |
InChI=1/C18H15O3P/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15H |
| Synonyms: |
Triphenyl Phosphite (TPPi);Triphenyl phospite;Triphenylphosphite white yellow xtl;TPPI; |
| Molecular Structure: |
 |
if you are sourcing Triphenyl Phosphite from China ,just feel free to inquire
CN
China Suppliers > Zhangjiagang Fortune Chemical Co., Ltd. > 
Search Product