Details for 3-Bromophenylacetic acid
3-Bromophenylacetic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1878-67-7 |
EC NO: |
217-522-1 |
Molecular Formula: |
C8H7BrO2 |
Molecular Weight: |
215.044 |
Specification: |
|
InChI: |
InChI=1/C8H7BrO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
Synonyms: |
RARECHEM AL BO 0120;Benzeneacetic acid, 3-bromo-;3-bromophenyl acetic acid;3-Bromophenylacetic acid;3-Bromobenzeneacetic acid;(3-Bromophenyl)acetic acid;(3-bromophenyl) acetic acid; |
Molecular Structure: |
|
if you are sourcing 3-Bromophenylacetic acid from India ,just feel free to inquire