Details for Diethyl Phthalate
Diethyl Phthalate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
84-66-2 |
EC NO: |
201-550-6 |
Molecular Formula: |
C12H14O4 |
Molecular Weight: |
222.2372 |
Specification: |
|
InChI: |
InChI:1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
Synonyms: |
Ethyl phthalate;Diethyl phthalate, (Phthalic acid diethyl ester);Phthalic Acid Diethyl Ester;DIETHYLPHTALATE;Benzene-1,2-dicarboxylic acid diethyl ester;diethyl benzene-1,2-dicarboxylate;DEP; |
Molecular Structure: |
|
if you are sourcing Diethyl Phthalate from Canada ,just feel free to inquire