Details for Biphenyl-3-boronic acid
Biphenyl-3-boronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
5122-95-2 |
EC NO: |
|
Molecular Formula: |
C12H11BO2 |
Molecular Weight: |
198.0255 |
Specification: |
|
InChI: |
InChI=1/C12H11BO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14-15H |
Synonyms: |
3-Biphenylboronic acid;(1,1-Biphenyl-3-yl)boronic acid;[1,1-Biphenyl]-3-ylboronic acid;[1,1'-Biphenyl]-3-ylboronic acid;biphenyl-3-ylboronic acid;3-Phenylbenzeneboronic acid;3-Biphenyl boronic acid; |
Molecular Structure: |
|
if you are sourcing Biphenyl-3-boronic acid from United-States ,just feel free to inquire