111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
5421-46-5 |
EC NO: |
226-540-9 |
Molecular Formula: |
C2H7NO2S |
Molecular Weight: |
109.1475 |
Specification: |
|
InChI: |
InChI=1/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
Product description:
CAS: 5421-46-5;Colorless to faint pink liquid with a repulsive, skunk-like odor.
|
Uses: |
Hair Perms, Hair Straightener, Anticorrosive |
Synonyms: |
Ammonium mercaptoacetate;Ammonium thioglycollate solution;Hair waving agent;Acetic acid, mercapto-, monoammonium salt;;ammonium sulfanylacetate; |
Molecular Structure: |
 |