Details for 2-Ethylhexyl Acrylate
2-Ethylhexyl Acrylate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
103-11-7 |
EC NO: |
203-080-7;249-707-8 |
Molecular Formula: |
C11H20O2 |
Molecular Weight: |
184.2753 |
Specification: |
|
InChI: |
InChI=1/C11H20O2/c1-4-7-8-10(5-2)9-13-11(12)6-3/h6,10H,3-5,7-9H2,1-2H3/t10-/m1/s1 |
Synonyms: |
1-Hexanol, 2-ethyl-, acrylate;2-ethylhexyl 2-propenoate;2-Ethylhexyl acrylate, stabilized with 10-20 ppm MEHQ;2-Ethylhexyl propenoate;2-Propenoic acid 2-ethylhexyl ester;2-Propenoic acid octyl ester;acrylic acid 2-ethylhexyl ester;2-ethylhexyl prop-2-enoate;octyl prop-2-enoate;(2S)-2-ethylhexyl prop-2-enoate;(2R)-2-ethylhexyl prop-2-enoate;2-Ethyl Hexyl Acrylate;2-ethylexyl acrylate;2EHA;2-Ethylhexyl Acrylate Monomer;2-EHA;Acrylic Acid Octyl Ester Monomer;Acrylic Acid Octyl Ester;iso-Octyl acrylate;Octylacrylate;6-methylheptyl prop-2-enoate; |
Molecular Structure: |
|
if you are sourcing 2-Ethylhexyl Acrylate from United-States ,just feel free to inquire