Details for N-Phenylanthranilic Acid
![](/images/home/newal1.gif)
N-Phenylanthranilic Acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
91-40-7 |
EC NO: |
202-066-8 |
Molecular Formula: |
C13H10NO2 |
Molecular Weight: |
212.2245 |
Specification: |
|
InChI: |
InChI=1/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16)/p-1 |
Synonyms: |
Diphenylamine-2-carboxylic acid;N-Phenyl 2-Aminobenzoic Acid;Benzoic acid, 2-(phenylamino)-;N-Phenyl o-aminobenzoic acid;2-(phenylamino)benzoic acid;2-(phenylamino)benzoatato(2-); |
Molecular Structure: |
![N-Phenylanthranilic Acid 91-40-7](https://images-a.chemnet.com/suppliers/chembase/432/4320.gif) |
if you are sourcing N-Phenylanthranilic Acid from United-States ,just feel free to inquire