Details for Ethyl Thioacetate
Ethyl Thioacetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
625-60-5 |
EC NO: |
261-601-3;210-904-9 |
Molecular Formula: |
C4H8OS |
Molecular Weight: |
104.1707 |
Specification: |
|
InChI: |
InChI=1/C4H8OS/c1-3-6-4(2)5/h3H2,1-2H3 |
Synonyms: |
Ethanethioic acid, ethyl ester;Acetic acid, thio-, ethyl ester;Ethyl ethanethioate;S-ethyl ethanethioate;S-Ethyl thioacetate;Thioacetic acid S-ethyl ester;O-ethyl ethanethioate;S-ethyl ethanethoate;S-ethylthioacetate;Ethanethioic Acid S-Ethyl Ester; |
Molecular Structure: |
|
if you are sourcing Ethyl Thioacetate from United-States ,just feel free to inquire