Details for Isonicotinic acid N-oxide
Isonicotinic acid N-oxide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
13602-12-5 |
EC NO: |
237-086-6 |
Molecular Formula: |
C6H4NO3 |
Molecular Weight: |
138.1014 |
Specification: |
|
InChI: |
InChI=1/C6H5NO3/c8-6(9)5-1-3-7(10)4-2-5/h1-4H,(H,8,9)/p-1 |
Synonyms: |
pyridin-N-oxide-4-carboxylic acid;isonicotinic-N-oxide acid;Pyridine-4-carboxylic acid N-oxide;Isonicotinic acid-N-oxide;pyridine-4-carboxylic acid 1-oxide;pyridine-4-carboxylate 1-oxide; |
Molecular Structure: |
|
if you are sourcing Isonicotinic acid N-oxide from Germany ,just feel free to inquire