Details for Sodium Laurate
Sodium Laurate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
629-25-4 |
EC NO: |
211-082-4 |
Molecular Formula: |
C12H23NaO2 |
Molecular Weight: |
222.2996 |
Specification: |
|
InChI: |
InChI=1/C12H24O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;/h2-11H2,1H3,(H,13,14);/q;+1/p-1 |
Synonyms: |
Dodecanoic acid, sodium salt;Sodium laurate;Caswell No. 778A;EPA Pesticide Chemical Code 079026;Lauran sodny;Lauran sodny [Czech];Lauric acid, sodium salt;Sodium dodecanoate;Dodecanoic acid, sodium salt (1:1) |
Molecular Structure: |
|
if you are sourcing Sodium Laurate from India ,just feel free to inquire