Details for D-erythro-N,N-Dimethylsphingosine

D-erythro-N,N-Dimethylsphingosine
| Category: |
Other Chemicals/Others |
|
| CAS NO: |
132031-17-5 |
| EC NO: |
|
| Molecular Formula: |
C20H41NO2 |
| Molecular Weight: |
327.545 |
| Specification: |
|
| InChI: |
InChI=1/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/b17-16+ |
| Synonyms: |
4-octadecene-1,3-diol, 2-(dimethylamino)-, (4E)-;(4E)-2-(dimethylamino)octadec-4-ene-1,3-diol; |
| Molecular Structure: |
 |
if you are sourcing D-erythro-N,N-Dimethylsphingosine from Canada ,just feel free to inquire