Details for L-Lactic Acid
L-Lactic Acid
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
79-33-4 |
EC NO: |
201-196-2 |
Molecular Formula: |
C3H6O3 |
Molecular Weight: |
90.08 |
Specification: |
|
InChI: |
InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 |
Synonyms: |
(S)-(+)-2-Hydroxypropanoic acid;L(+)-Lactic acid solution;L-Lactic acid, free acid;lactate standard 40 mg/dl;L(+)lactic acid free acid sigmaultra;L-Lactic acid;(S)-2-Hydroxypropionic acid;L(+)-Lactic Acid; |
Molecular Structure: |
|
if you are sourcing L-Lactic Acid from Canada ,just feel free to inquire