Details for HMPA Linker
HMPA Linker
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
68858-21-9 |
EC NO: |
|
Molecular Formula: |
C9H9O4 |
Molecular Weight: |
181.1659 |
Specification: |
|
InChI: |
InChI=1/C9H10O4/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4,10H,5-6H2,(H,11,12)/p-1 |
Synonyms: |
P-(hydroxymethyl)phenoxyacetic acid;hpa linker;hmp;hmpa linker;hmp linker;4-(hydroxymethyl)phenoxyacetic acid;fmoc-scal-linker (safety-catch linker for solid phase synthesis);p-hydroxymethyl phenoxyacetic acid;[4-(hydroxymethyl)phenoxy]acetate;4-(Hydroxymethyl)Phenoxy acetic Acid; |
Molecular Structure: |
|
if you are sourcing HMPA Linker from United-States ,just feel free to inquire