Details for BISMUTH SUBGALLATE

BISMUTH SUBGALLATE
| Category: |
Inorganic chemicals |
|
| CAS NO: |
22650-86-8 |
| EC NO: |
202-742-2 |
| Molecular Formula: |
C7H8BiO6 |
| Molecular Weight: |
397.1152 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2 |
| Synonyms: |
S-(2-Benzothiazoleyl)-2-(2-aminothiazol-4-yl)-(z)-2-methoxyimino thioacetate;benzoic acid, 3,4,5-trihydroxy-, bismuth salt (1:1), monohydrate; |
if you are sourcing BISMUTH SUBGALLATE from United-States ,just feel free to inquire