Details for Cinnamic acid ethylester
![](/images/home/newal1.gif)
Cinnamic acid ethylester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
103-36-6 |
EC NO: |
203-104-6 |
Molecular Formula: |
C11H12O2 |
Molecular Weight: |
176.2118 |
Specification: |
|
InChI: |
InChI=1/C11H12O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-9H,2H2,1H3/b9-8- |
Synonyms: |
Cinnamic acid ethyl ester;ethyl 3-phenylprop-2-enoate;ethyl 2-phenylprop-2-enoate;ethyl (2E)-3-phenylprop-2-enoate;benzyl (2E)-3-phenylprop-2-enoate;ethyl (2Z)-3-phenylprop-2-enoate; |
Molecular Structure: |
![Cinnamic acid ethylester 103-36-6](https://images-a.chemnet.com/suppliers/chembase/336/3363.gif) |
if you are sourcing Cinnamic acid ethylester from France ,just feel free to inquire