Details for Dodecanoic acid

Dodecanoic acid
111Category: |
Dyestuffs and Pigments/Disperse Dyes |
|
CAS NO: |
143-07-7 |
EC NO: |
205-582-1 |
Molecular Formula: |
C12H24O2 |
Molecular Weight: |
200.3178 |
Specification: |
|
InChI: |
InChI=1/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
Synonyms: |
Dodecanoic acid;lauric acid free acid sigma grade;lauric acid, pure;Lauric acid 98-101 % (acidimetric);Lauric Acid (Dodecanoic acid,C12); |
Molecular Structure: |
 |
if you are sourcing Dodecanoic acid from France ,just feel free to inquire