Details for diethyl 1,1-cyclopropane dicarboxylate
![](/images/home/newal1.gif)
diethyl 1,1-cyclopropane dicarboxylate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
1559-02-0 |
EC NO: |
216-321-6 |
Molecular Formula: |
C9H14O4 |
Molecular Weight: |
186.2051 |
Specification: |
|
InChI: |
InChI=1/C9H14O4/c1-3-12-7(10)9(5-6-9)8(11)13-4-2/h3-6H2,1-2H3 |
Synonyms: |
1,1-Cyclopropanedicarboxylic acid diethyl ester;diethyl cyclopropane-1,1-dicarboxylate;Diethyl-1,1-cyclopropane dicarboxylate; |
Molecular Structure: |
![diethyl 1,1-cyclopropane dicarboxylate 1559-02-0](https://images-a.chemnet.com/suppliers/chembase/421/104421.gif) |
if you are sourcing diethyl 1,1-cyclopropane dicarboxylate from France ,just feel free to inquire