Details for Dimethyl Phthalate

Dimethyl Phthalate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
131-11-3 |
EC NO: |
205-011-6 |
Molecular Formula: |
C10H10O4 |
Molecular Weight: |
194.19 |
Specification: |
|
InChI: |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
Synonyms: |
Dimethyl 1,2-benzenedicarboxylate;D.M.P;Phthalic acid dimethyl ester;Benzene-1,2-dicarboxylic acid dimethyl ester;1,2-benzenedicarboxylic acid dimethyl ester;DMP; |
Molecular Structure: |
 |
if you are sourcing Dimethyl Phthalate from Germany ,just feel free to inquire