Germany Hygromycin B Suppliers, Germany Hygromycin B Manufacturers.

ChemNet  |   Sign in  |   Join Now
AppliChem mbH
https://www.chemnet.com/GermanySuppliers/19933/
Germany Suppliers > applichem >

Hygromycin B

Details for Hygromycin B

Hygromycin B

111Category:

Pharmaceuticals and Biochemicals

Hygromycin B
CAS NO: 31282-04-9
EC NO: 250-545-5
Molecular Formula: C20H37N3O13
Molecular Weight: 527.5201
Specification:
InChI: InChI=1/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6?,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20?/m1/s1
Synonyms: hygromycin B from streptomyces*hygroscopicus;Hygromycin B solution Streptomyces hygroscopicus;hygromycin B aqueous solution;hygromycin B plant cell culture tested;Hygromycin B;Hygromycin B Streptomyces hygroscopicus;Hygromycin B - Solution;(3'R,3aS,4S,4'R,5'R,6R,6'R,7S,7aS)-4-{[(1R,2S,3R,5S,6R)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol (non-preferred name);
Molecular Structure: Hygromycin B 31282-04-9
if you are sourcing Hygromycin B from Germany ,just feel free to inquire
ChemNet  |   Product  |   Suppliers  |   Buy  |   Sell  |   News  |   REACH  |   Directory  |   CAS  |   Resource
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd.