Details for glycidyl methacrylate

glycidyl methacrylate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
106-91-2 |
EC NO: |
203-441-9 |
Molecular Formula: |
C7H10O3 |
Molecular Weight: |
142.1525 |
Specification: |
|
InChI: |
InChI=1/C7H10O3/c1-5(2)7(8)10-4-6-3-9-6/h6H,1,3-4H2,2H3/t6-/m1/s1 |
Synonyms: |
2,3-Epoxypropyl methacrylate;Methacrylic acid glycidyl ester;oxiran-2-ylmethyl 2-methylprop-2-enoate;(2S)-oxiran-2-ylmethyl 2-methylprop-2-enoate;(2R)-oxiran-2-ylmethyl 2-methylprop-2-enoate;2-Propenoic acid,2-methyl-,2-oxiranylmethyl ester;Epoxypropyl methacrylate;GMA;Glydidyl methacrylate; |
Molecular Structure: |
 |
if you are sourcing glycidyl methacrylate from Germany ,just feel free to inquire