Details for 5-Nitroisophthalic acid monomethyl ester

5-Nitroisophthalic acid monomethyl ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1955-46-0 |
EC NO: |
217-793-6 |
Molecular Formula: |
C9H6NO6 |
Molecular Weight: |
224.1476 |
Specification: |
|
InChI: |
InChI=1/C9H7NO6/c1-16-9(13)6-2-5(8(11)12)3-7(4-6)10(14)15/h2-4H,1H3,(H,11,12)/p-1 |
Synonyms: |
5-Nitroisophthalic acid monomethyl ester;mono-Methyl 5-nitroisophthalate;Monomethyl 5-nitrobenzene-1,3-dicarboxylate;5-nitro isophthalic acid monomethyl ester;3-(methoxycarbonyl)-5-nitrobenzoic acid;3-(methoxycarbonyl)-5-nitrobenzoate;methyl 5-nitroisophthalate; |
Molecular Structure: |
 |
if you are sourcing 5-Nitroisophthalic acid monomethyl ester from Germany ,just feel free to inquire