111Category: |
Inorganic chemicals |
|
CAS NO: |
72-18-4 |
EC NO: |
200-773-6 |
Molecular Formula: |
C5H11NO2 |
Molecular Weight: |
117.1478 |
Specification: |
|
InChI: |
InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
Product description:
Essential amino acid
Extends anabolic effects in the muscular system
During glycogene deficiency, may act as energy supplier
Increases the secretion of insulin
Counteracts the excessive formation of serotonine in the brain, and is therefor |
Synonyms: |
L-2-Amino-3-methylbutyric acid;L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade;H-Val-OH;2-Amino-3-methylbutanoic acid;Lvaline;L-2-Aminoisovaleric acid;(S)-(+)-2-Amino-3-methylbutyric acid;;1-2-Amino-3-methylbutyric acid;Valine; |
Molecular Structure: |
![L-Valine 72-18-4](https://images-a.chemnet.com/suppliers/chembase/298/2984.gif) |