Details for Para Chloro Benzyl Cyanide
![](/images/home/newal1.gif)
Para Chloro Benzyl Cyanide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
140-53-4 |
EC NO: |
205-418-9 |
Molecular Formula: |
C8H6ClN |
Molecular Weight: |
151.5929 |
Specification: |
|
InChI: |
InChI=1/C8H6ClN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
Synonyms: |
(4-chlorophenyl)acetonitrile;chlorobenzylcyanide-4;pccn;p-chlorobenzyl cyanide;p-chlorophenylacetonitrile;4-Cyanobenzylchloride;Para-chlorobenzyl cyanide |
Molecular Structure: |
![Para Chloro Benzyl Cyanide 140-53-4](https://images-a.chemnet.com/suppliers/chembase/295/295052_1.gif) |
if you are sourcing Para Chloro Benzyl Cyanide from India ,just feel free to inquire