Details for Zinc nitrate hexahydrate
Zinc nitrate hexahydrate
111Category: |
Inorganic chemicals |
|
CAS NO: |
10196-18-6 |
EC NO: |
231-943-8 |
Molecular Formula: |
H12NO9Zn |
Molecular Weight: |
235.505 |
Specification: |
|
InChI: |
InChI=1/NO3.6H2O.Zn/c2-1(3)4;;;;;;;/h;6*1H2;/q-1;;;;;;;+2 |
Synonyms: |
Zinc nitrate;ZN(NO3)2;ZINC ICP STANDARD, ZN(NO3)2;Zincnitrate(metalsbasis);Zinc nitrate hydrate;zinc dinitrate;methane, compd. with nitric acid, zinc salt (6:2:1); |
Molecular Structure: |
|
if you are sourcing Zinc nitrate hexahydrate from India ,just feel free to inquire