Details for Bromoacetaldehyde diethyl acetal

Bromoacetaldehyde diethyl acetal
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
2032-35-1 |
EC NO: |
217-989-1 |
Molecular Formula: |
C6H13BrO2 |
Molecular Weight: |
197.0702 |
Specification: |
|
InChI: |
InChI=1/C6H13BrO2/c1-3-8-6(5-7)9-4-2/h6H,3-5H2,1-2H3 |
Synonyms: |
2-Bromo-1,1-diethoxyethane;Bromoacetal;Bromoacetal dehyde diethyl acetal;Bromoacetaldehydediethylacetal;Bromo acetaldehyde diethyl acetal;Bromoacetaldehyde diethyl acetal; |
Molecular Structure: |
 |
if you are sourcing Bromoacetaldehyde diethyl acetal from India ,just feel free to inquire