Details for Phenyl Ethyl Methyl Ether
Phenyl Ethyl Methyl Ether
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
111767-38-5 |
EC NO: |
|
Molecular Formula: |
C9H12O |
Molecular Weight: |
136.191 |
Specification: |
|
InChI: |
InChI=1/C9H12O/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
Synonyms: |
(1-Methoxyethyl)benzene;benzene, (1-methoxyethyl)-;Ether, methyl .alpha.-methylbenzyl;Methyl 1-phenylethyl ether;Methyl phenylethyl ether;Phenylethyl methyl ether; |
Molecular Structure: |
|
if you are sourcing Phenyl Ethyl Methyl Ether from India ,just feel free to inquire