Details for Propanedioic acid (2-thienyl methyl) dimethyl ester

Propanedioic acid (2-thienyl methyl) dimethyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
122308-25-2 |
EC NO: |
|
Molecular Formula: |
C10H12O4S |
Molecular Weight: |
228.2649 |
Specification: |
|
InChI: |
InChI=1/C10H12O4S/c1-13-9(11)8(10(12)14-2)6-7-4-3-5-15-7/h3-5,8H,6H2,1-2H3 |
Synonyms: |
PROPANEDIOIC ACID (2-THIENYL METHYL)DIMETHYL ESTER;Dimethyl (2-thienylmethyl)malonate, 95%;dimethyl (thiophen-2-ylmethyl)propanedioate; |
Molecular Structure: |
 |
if you are sourcing Propanedioic acid (2-thienyl methyl) dimethyl ester from India ,just feel free to inquire