Details for Methyl Ethyl Ketoxime
Methyl Ethyl Ketoxime
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
96-29-7 |
EC NO: |
202-496-6 |
Molecular Formula: |
C4H9NO |
Molecular Weight: |
87.1204 |
Specification: |
|
InChI: |
InChI=1/C4H9NO/c1-3-4(2)5-6/h6H,3H2,1-2H3/b5-4- |
Synonyms: |
2-Butanone oxime;2-butoxime;aron m 1;butanone oxime;ethyl methyl ketoxime;Methyl ethyl ketoxime;(2E)-butan-2-one oxime;(2Z)-butan-2-one oxime;MEKO; |
Molecular Structure: |
|
if you are sourcing Methyl Ethyl Ketoxime from India ,just feel free to inquire