Details for 4-Methyl Benzyl Alcohol
![](/images/home/newal1.gif)
4-Methyl Benzyl Alcohol
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
589-18-4 |
EC NO: |
209-639-1 |
Molecular Formula: |
C8H10O |
Molecular Weight: |
122.17 |
Specification: |
|
InChI: |
InChI=1/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3 |
Synonyms: |
Methylbenzylalcohol;4-Metylbenzyl Alcohol;4-(hydroxymethyl)toluene;4-methyl benzenemethanol;p-toluyl alcohol;p-tolylcarbinol;p-Methylbenzyl alcohol; |
Molecular Structure: |
![4-Methyl Benzyl Alcohol 589-18-4](https://images-a.chemnet.com/suppliers/chembase/379/3791.gif) |
if you are sourcing 4-Methyl Benzyl Alcohol from India ,just feel free to inquire