Details for 4-Methyl Benzyl Cyanide
4-Methyl Benzyl Cyanide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2947-61-7 |
EC NO: |
220-963-2 |
Molecular Formula: |
C9H9N |
Molecular Weight: |
131.1745 |
Specification: |
|
InChI: |
InChI=1/C9H9N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6H2,1H3 |
Synonyms: |
4-Methylphenylacetonitrile;p-Tolylacetonitrile;4-Methylacetonitrile;4-methyl-benzeneacetonitrile;p-methylbenzyl cyanide;4-methyl phenyl aceto nitrile;para methylbenzyl cyanide;2-(p-tolyl)acetonitrile;p-Toluylacetonitrile;4-Methylphenyl acetonitrile; |
Molecular Structure: |
|
if you are sourcing 4-Methyl Benzyl Cyanide from India ,just feel free to inquire