Details for Para-Methylbenzophenone

Para-Methylbenzophenone
111Category: |
Intermediates |
|
CAS NO: |
134-84-9 |
EC NO: |
205-159-1 |
Molecular Formula: |
C14H18O |
Molecular Weight: |
202.2921 |
Specification: |
|
InChI: |
InChI=1/C14H18O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3 |
Packing: |
The substance is packed in Fibre Drums. 25 Kg./50 Kg. |
Product description:
As uv absorber, pharmaceutical intermediates;UV GuHuaXing coating and ink
|
Synonyms: |
(4-Methylphenyl)phenylmethanone;Phenyl p-tolyl ketone;4-Methylbenzophenone,(Phenyl p-tolyl ketone);Photoinitiator-4MBP;cyclohexyl(4-methylphenyl)methanone;4-methlybenzophenone;p-Methyl Benzophenone;4-methybenzophenone; |
Molecular Structure: |
 |
if you are sourcing Para-Methylbenzophenone from India ,just feel free to inquire