Details for 1,3-Acetonedicarboxylic acid Dimethyl Ester
![](/images/home/newal1.gif)
1,3-Acetonedicarboxylic acid Dimethyl Ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
1830-54-2 |
EC NO: |
217-385-8 |
Molecular Formula: |
C7H10O5 |
Molecular Weight: |
174.1513 |
Specification: |
|
InChI: |
InChI=1/C7H10O5/c1-11-6(9)3-5(8)4-7(10)12-2/h3-4H2,1-2H3 |
Synonyms: |
Dimethyl 3-oxoglutarate;1,3-Acetonedicarboxylic acid dimethyl ester;beta-Ketoglutaric acid dimethyl ester;Dimethyl 3-oxopentanedioate;Dimethyl-1,3-Acetonedicarboxylate;Dimethyl acetone-1,3-dicarboxylate;Dimethyl 1,3-acetone dicarboxylate;3-oxo-pentanedioicaci dimethyl ester;Dimethyl-3-oxoglutarate;3-oxo-pentanedioicacidimethylester; |
Molecular Structure: |
![1,3-Acetonedicarboxylic acid Dimethyl Ester 1830-54-2](https://images-a.chemnet.com/suppliers/chembase/125/1258.gif) |
if you are sourcing 1,3-Acetonedicarboxylic acid Dimethyl Ester from India ,just feel free to inquire