111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
2387-23-7 |
EC NO: |
219-213-7 |
Molecular Formula: |
C13H24N2O |
Molecular Weight: |
224.3425 |
Specification: |
|
InChI: |
InChI=1/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
Product description:
Eyes: Wear appropriate protective eyeglasses or chemical safety goggles as described by OSHA's eye and face protection regulations in 29 CFR 1910.133 or European Standard EN166. Skin: Wear appropriate protective gloves to prevent skin exposure. Clothing: Wear appropriate protective clothing to prevent skin exposure.
|
Synonyms: |
N,N-Dicyclohexylurea;1,3-dicyclohexylurea; |
Molecular Structure: |
 |