Details for 4-Methoxy -2 Methyl Di Phenyl Amine

4-Methoxy -2 Methyl Di Phenyl Amine
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
41317-15-1 |
EC NO: |
255-310-0 |
Molecular Formula: |
C14H15NO |
Molecular Weight: |
213.275 |
Specification: |
|
InChI: |
InChI=1/C14H15NO/c1-11-10-13(16-2)8-9-14(11)15-12-6-4-3-5-7-12/h3-10,15H,1-2H3 |
Synonyms: |
4-Methoxy-2-methyldiphenylamine;4-Methoxy-2-methyl diphenyl amine;4-methoxy-2-methyl-N-phenylaniline;2-Methyl-4-Methoxydiphenylamine; |
Molecular Structure: |
 |
if you are sourcing 4-Methoxy -2 Methyl Di Phenyl Amine from India ,just feel free to inquire