Details for Tri-Methyl Amine Hydrochloride
![](/images/home/newal1.gif)
Tri-Methyl Amine Hydrochloride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
593-81-7 |
EC NO: |
209-810-0 |
Molecular Formula: |
C3H10ClN |
Molecular Weight: |
95.5712 |
Specification: |
|
InChI: |
InChI=1/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H |
Synonyms: |
Trimethylammonium chloride;Trimethylamine HCL;TRIMETHYLAMINE CHLORHYDRATE;N,N-dimethylmethanaminium chloride;Trimethylamine hydrochloride; |
Molecular Structure: |
![Tri-Methyl Amine Hydrochloride 593-81-7](https://images-a.chemnet.com/suppliers/chembase/292/2921.gif) |
if you are sourcing Tri-Methyl Amine Hydrochloride from India ,just feel free to inquire