Details for Phenyl Acetic Acid
Phenyl Acetic Acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
103-82-2 |
EC NO: |
203-148-6 |
Molecular Formula: |
C8H8O2 |
Molecular Weight: |
136.1479 |
Specification: |
|
InChI: |
InChI=1/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
Synonyms: |
a-Tolylic Acid;alpha-Tolylic acid;2-Phenylacetic acid;alpha-Toluic acid;Benzeneacetic acid;2-oxo-3-phenylpropanoic acid;sodium phenylacetate;ammonium phenylacetate;calcium bis(phenylacetate);phenylacetate;Phenoxacetic acid; |
Molecular Structure: |
|
if you are sourcing Phenyl Acetic Acid from India ,just feel free to inquire