Details for Methyl 3-aminocrotonate

Methyl 3-aminocrotonate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
21731-17-9 |
EC NO: |
244-549-6;238-056-5 |
Molecular Formula: |
C5H9NO2 |
Molecular Weight: |
115.1305 |
Specification: |
|
InChI: |
InChI=1/C5H9NO2/c1-4(6)3-5(7)8-2/h6H,3H2,1-2H3/b6-4+ |
Synonyms: |
2-Butenoic acid, 3-amino-, methyl ester;methyl 3-amino-trans-but-2-enoate;3-Aminocrotonic acid methyl ester;Methyl-3-amino crotonate;methyl 3-aminobut-2-enoate;methyl (2E)-3-aminobut-2-enoate;methyl (2Z)-3-aminobut-2-enoate;methyl (3E)-3-iminobutanoate;Methyl ¦Â-aminobutenate;Methyl 3-aminocroton;Methyl-3-Aminocrotorate; |
Molecular Structure: |
 |
if you are sourcing Methyl 3-aminocrotonate from Israel ,just feel free to inquire