Details for 2-Bromophenylacetic acid
2-Bromophenylacetic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
18698-97-0 |
EC NO: |
242-509-2 |
Molecular Formula: |
C8H7BrO2 |
Molecular Weight: |
215.0366 |
Specification: |
|
InChI: |
InChI=1/C8H7BrO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
Synonyms: |
-RARECHEM AL BO 0109;O-BROMOPHENYLACETIC ACID;TIMTEC-BB SBB006626;LABOTEST-BB LT00454446;2-Bromophenylacetic acid, 98+%;Benzeneacetic acid, 2-bromo-;2-(2-Bromophenyl)acetic acid;(2-bromophenyl)acetate; |
Molecular Structure: |
|
if you are sourcing 2-Bromophenylacetic acid from Israel ,just feel free to inquire