Details for Ethyl 2-bromomyristate

Ethyl 2-bromomyristate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
14980-92-8 |
EC NO: |
239-059-4 |
Molecular Formula: |
C16H31BrO2 |
Molecular Weight: |
335.3201 |
Specification: |
|
InChI: |
InChI=1/C16H31BrO2/c1-3-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19-4-2/h15H,3-14H2,1-2H3 |
Synonyms: |
Ethyl-2-bromomyristate;2-bromo-tetradecanoicaciethylester;Ethyl alpha-bromomyristate;Tetradecanoic acid, 2-bromo-, ethyl ester;ETHYL 2-BROMOTETRADECANOATE;ETHYL-2-BROMO-TETRADECANOIC ACID;¦Á-Bromo-tetradecanoic acid ethyl ester;2-Bromotetradecanoic acid ethyl ester;Ethyl ¦Á-bromotetradecanoate; |
Molecular Structure: |
 |
if you are sourcing Ethyl 2-bromomyristate from Israel ,just feel free to inquire