Details for Ethyl 3-bromopropionate
![](/images/home/newal1.gif)
Ethyl 3-bromopropionate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
539-74-2 |
EC NO: |
208-724-0 |
Molecular Formula: |
C5H9BrO2 |
Molecular Weight: |
181.0278 |
Specification: |
|
InChI: |
InChI=1/C5H9BrO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 |
Synonyms: |
Ethyl ¦Â-bromopropionate; Ethyl 3-Bromopropanoate;3-Bromopropanoic acid ethyl ester;ethyl 3-bromopropanoate;Ethyl-3-bromopropionate;3-bromopropionic acid ethyl ester; |
Molecular Structure: |
![Ethyl 3-bromopropionate 539-74-2](https://images-a.chemnet.com/suppliers/chembase/198/198440_1.gif) |
if you are sourcing Ethyl 3-bromopropionate from Israel ,just feel free to inquire